C14H20BN2O3 — CID 163403651
CID 163403651 (PubChem CID 163403651) has the molecular formula C14H20BN2O3 and a molecular weight of 275.14 g/mol.
| Compound Name | CID 163403651 |
|---|---|
| PubChem CID | 163403651 |
| Molecular Formula | C14H20BN2O3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | — |
| SMILES | C[B]N1CCN(C(=O)c2cccc(OC)c2OC)CC1 |
| InChI | InChI=1S/C14H20BN2O3/c1-15-17-9-7-16(8-10-17)14(18)11-5-4-6-12(19-2)13(11)20-3/h4-6H,7-10H2,1-3H3 |
| InChIKey | CVSJMLJMUVYRKB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|