C19H25NO4 — CID 70288845
2-methylpropyl (2S,3R)-3-hydroxy-3-(3-hydroxyprop-1-ynyl)-2-phenylpiperidine-1-carboxylate (PubChem CID 70288845) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-methylpropyl (2S,3R)-3-hydroxy-3-(3-hydroxyprop-1-ynyl)-2-phenylpiperidine-1-carboxylate.
| Compound Name | 2-methylpropyl (2S,3R)-3-hydroxy-3-(3-hydroxyprop-1-ynyl)-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 70288845 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-methylpropyl (2S,3R)-3-hydroxy-3-(3-hydroxyprop-1-ynyl)-2-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC[C@@](O)(C#CCO)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-15(2)14-24-18(22)20-12-6-10-19(23,11-7-13-21)17(20)16-8-4-3-5-9-16/h3-5,8-9,15,17,21,23H,6,10,12-14H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | YWWDFALAPGIWIG-PKOBYXMFSA-N |
| XLogP | 2.34 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|