C14H15NO2 — CID 11253195
methyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate (PubChem CID 11253195) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11253195 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | methyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC1C#Cc1ccccc1 |
| InChI | InChI=1S/C14H15NO2/c1-17-14(16)15-11-5-8-13(15)10-9-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8,11H2,1H3 |
| InChIKey | CGYOQKMJIPLPIL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|