C17H20BrNO4 — CID 102431225
methyl (2R)-2-[2-(2-bromo-4,5-dimethoxyphenyl)ethynyl]piperidine-1-carboxylate (PubChem CID 102431225) has the molecular formula C17H20BrNO4 and a molecular weight of 382.25 g/mol. Its IUPAC name is methyl (2R)-2-[2-(2-bromo-4,5-dimethoxyphenyl)ethynyl]piperidine-1-carboxylate.
| Compound Name | methyl (2R)-2-[2-(2-bromo-4,5-dimethoxyphenyl)ethynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102431225 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | methyl (2R)-2-[2-(2-bromo-4,5-dimethoxyphenyl)ethynyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC[C@@H]1C#Cc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C17H20BrNO4/c1-21-15-10-12(14(18)11-16(15)22-2)7-8-13-6-4-5-9-19(13)17(20)23-3/h10-11,13H,4-6,9H2,1-3H3/t13-/m1/s1 |
| InChIKey | JCBYFQZEQUPCSK-CYBMUJFWSA-N |
| XLogP | 3.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|