C18H24N2O3 — CID 134793006
methyl 2-(4-phenylpiperidine-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 134793006) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 2-(4-phenylpiperidine-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-(4-phenylpiperidine-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134793006 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl 2-(4-phenylpiperidine-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC1C(=O)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N2O3/c1-23-18(22)20-11-5-8-16(20)17(21)19-12-9-15(10-13-19)14-6-3-2-4-7-14/h2-4,6-7,15-16H,5,8-13H2,1H3 |
| InChIKey | GSNMBHWMFCLUIK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |