C19H27N3O4 — CID 97192692
methyl (2R)-2-[4-(pyridin-3-ylmethoxy)piperidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 97192692) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is methyl (2R)-2-[4-(pyridin-3-ylmethoxy)piperidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | methyl (2R)-2-[4-(pyridin-3-ylmethoxy)piperidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97192692 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | methyl (2R)-2-[4-(pyridin-3-ylmethoxy)piperidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC[C@@H]1C(=O)N1CCC(OCc2cccnc2)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-25-19(24)22-10-3-2-6-17(22)18(23)21-11-7-16(8-12-21)26-14-15-5-4-9-20-13-15/h4-5,9,13,16-17H,2-3,6-8,10-12,14H2,1H3/t17-/m1/s1 |
| InChIKey | XGXUYRWJOSANNW-QGZVFWFLSA-N |
| XLogP | 2.21 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |