C20H27FN2O3 — CID 97201426
methyl (2R)-2-[4-[(2-fluorophenyl)methyl]piperidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 97201426) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(2-fluorophenyl)methyl]piperidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | methyl (2R)-2-[4-[(2-fluorophenyl)methyl]piperidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97201426 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | methyl (2R)-2-[4-[(2-fluorophenyl)methyl]piperidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC[C@@H]1C(=O)N1CCC(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H27FN2O3/c1-26-20(25)23-11-5-4-8-18(23)19(24)22-12-9-15(10-13-22)14-16-6-2-3-7-17(16)21/h2-3,6-7,15,18H,4-5,8-14H2,1H3/t18-/m1/s1 |
| InChIKey | ARUINDAIVRCPOZ-GOSISDBHSA-N |
| XLogP | 3.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |