C14H17FN2O3 — CID 110754462
methyl 2-[(2-fluorophenyl)methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 110754462) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is methyl 2-[(2-fluorophenyl)methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-[(2-fluorophenyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 110754462 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl 2-[(2-fluorophenyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC1C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C14H17FN2O3/c1-20-14(19)17-8-4-7-12(17)13(18)16-9-10-5-2-3-6-11(10)15/h2-3,5-6,12H,4,7-9H2,1H3,(H,16,18) |
| InChIKey | LRMNFHCKMVCBLE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |