C18H21FN4O — CID 167932463
[3-[(2-fluorophenyl)methyl]pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)methanone (PubChem CID 167932463) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is [3-[(2-fluorophenyl)methyl]pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)methanone.
| Compound Name | [3-[(2-fluorophenyl)methyl]pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 167932463 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [3-[(2-fluorophenyl)methyl]pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)methanone |
| SMILES | O=C(C1CCCc2ncnn21)N1CCC(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C18H21FN4O/c19-15-5-2-1-4-14(15)10-13-8-9-22(11-13)18(24)16-6-3-7-17-20-12-21-23(16)17/h1-2,4-5,12-13,16H,3,6-11H2 |
| InChIKey | XBAVOQSZBAXOIW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |