C29H33FN2O2 — CID 129455337
[4-[(2-fluorophenyl)methyl]oxan-4-yl]-[(4S)-4-(quinolin-3-ylmethyl)azepan-1-yl]methanone (PubChem CID 129455337) has the molecular formula C29H33FN2O2 and a molecular weight of 460.59 g/mol. Its IUPAC name is [4-[(2-fluorophenyl)methyl]oxan-4-yl]-[(4S)-4-(quinolin-3-ylmethyl)azepan-1-yl]methanone.
| Compound Name | [4-[(2-fluorophenyl)methyl]oxan-4-yl]-[(4S)-4-(quinolin-3-ylmethyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 129455337 |
| Molecular Formula | C29H33FN2O2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [4-[(2-fluorophenyl)methyl]oxan-4-yl]-[(4S)-4-(quinolin-3-ylmethyl)azepan-1-yl]methanone |
| SMILES | O=C(N1CCC[C@@H](Cc2cnc3ccccc3c2)CC1)C1(Cc2ccccc2F)CCOCC1 |
| InChI | InChI=1S/C29H33FN2O2/c30-26-9-3-1-8-25(26)20-29(12-16-34-17-13-29)28(33)32-14-5-6-22(11-15-32)18-23-19-24-7-2-4-10-27(24)31-21-23/h1-4,7-10,19,21-22H,5-6,11-18,20H2/t22-/m1/s1 |
| InChIKey | HZZMGXVGFBQNCL-JOCHJYFZSA-N |
| XLogP | 5.58 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |