C27H29FN2O2 — CID 124984247
[4-(2-fluorophenyl)oxan-4-yl]-[(3S)-3-(quinolin-6-ylmethyl)piperidin-1-yl]methanone (PubChem CID 124984247) has the molecular formula C27H29FN2O2 and a molecular weight of 432.54 g/mol. Its IUPAC name is [4-(2-fluorophenyl)oxan-4-yl]-[(3S)-3-(quinolin-6-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(2-fluorophenyl)oxan-4-yl]-[(3S)-3-(quinolin-6-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124984247 |
| Molecular Formula | C27H29FN2O2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [4-(2-fluorophenyl)oxan-4-yl]-[(3S)-3-(quinolin-6-ylmethyl)piperidin-1-yl]methanone |
| SMILES | O=C(N1CCC[C@@H](Cc2ccc3ncccc3c2)C1)C1(c2ccccc2F)CCOCC1 |
| InChI | InChI=1S/C27H29FN2O2/c28-24-8-2-1-7-23(24)27(11-15-32-16-12-27)26(31)30-14-4-5-21(19-30)17-20-9-10-25-22(18-20)6-3-13-29-25/h1-3,6-10,13,18,21H,4-5,11-12,14-17,19H2/t21-/m0/s1 |
| InChIKey | NJKKKNYQOXRXIJ-NRFANRHFSA-N |
| XLogP | 4.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |