C19H19N3O2 — CID 118739871
1,3-oxazol-5-yl-[4-(quinolin-3-ylmethyl)piperidin-1-yl]methanone (PubChem CID 118739871) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1,3-oxazol-5-yl-[4-(quinolin-3-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | 1,3-oxazol-5-yl-[4-(quinolin-3-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118739871 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1,3-oxazol-5-yl-[4-(quinolin-3-ylmethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cnco1)N1CCC(Cc2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C19H19N3O2/c23-19(18-12-20-13-24-18)22-7-5-14(6-8-22)9-15-10-16-3-1-2-4-17(16)21-11-15/h1-4,10-14H,5-9H2 |
| InChIKey | UPBNFEHSHXHUDQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |