C23H25N3O — CID 158349781
N-(4-methylphenyl)-4-(quinolin-3-ylmethyl)piperidine-1-carboxamide (PubChem CID 158349781) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-(quinolin-3-ylmethyl)piperidine-1-carboxamide.
| Compound Name | N-(4-methylphenyl)-4-(quinolin-3-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 158349781 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-(4-methylphenyl)-4-(quinolin-3-ylmethyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC(Cc3cnc4ccccc4c3)CC2)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-17-6-8-21(9-7-17)25-23(27)26-12-10-18(11-13-26)14-19-15-20-4-2-3-5-22(20)24-16-19/h2-9,15-16,18H,10-14H2,1H3,(H,25,27) |
| InChIKey | DOGNPYVKFIERDV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |