C17H18O — CID 101359434
(1R,7S,8S)-1-(2-phenylethynyl)bicyclo[5.1.0]octane-8-carbaldehyde (PubChem CID 101359434) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is (1R,7S,8S)-1-(2-phenylethynyl)bicyclo[5.1.0]octane-8-carbaldehyde.
| Compound Name | (1R,7S,8S)-1-(2-phenylethynyl)bicyclo[5.1.0]octane-8-carbaldehyde |
|---|---|
| PubChem CID | 101359434 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (1R,7S,8S)-1-(2-phenylethynyl)bicyclo[5.1.0]octane-8-carbaldehyde |
| SMILES | O=C[C@H]1[C@@H]2CCCCC[C@]12C#Cc1ccccc1 |
| InChI | InChI=1S/C17H18O/c18-13-16-15-9-5-2-6-11-17(15,16)12-10-14-7-3-1-4-8-14/h1,3-4,7-8,13,15-16H,2,5-6,9,11H2/t15-,16-,17+/m0/s1 |
| InChIKey | TVDGNGSUHPPTSF-YESZJQIVSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|