C24H26O4S — CID 101359427
[(1S,2R)-2-(2-oxoethyl)-2-(2-phenylethynyl)cycloheptyl] 4-methylbenzenesulfonate (PubChem CID 101359427) has the molecular formula C24H26O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is [(1S,2R)-2-(2-oxoethyl)-2-(2-phenylethynyl)cycloheptyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R)-2-(2-oxoethyl)-2-(2-phenylethynyl)cycloheptyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101359427 |
| Molecular Formula | C24H26O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(1S,2R)-2-(2-oxoethyl)-2-(2-phenylethynyl)cycloheptyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCCCC[C@]2(C#Cc2ccccc2)CC=O)cc1 |
| InChI | InChI=1S/C24H26O4S/c1-20-11-13-22(14-12-20)29(26,27)28-23-10-6-3-7-16-24(23,18-19-25)17-15-21-8-4-2-5-9-21/h2,4-5,8-9,11-14,19,23H,3,6-7,10,16,18H2,1H3/t23-,24-/m0/s1 |
| InChIKey | XAXBPPCDHFRFOU-ZEQRLZLVSA-N |
| XLogP | 4.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|