C24H21NO3S — CID 24777693
[2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-yl] 4-methylbenzenesulfonate (PubChem CID 24777693) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24777693 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-(2-phenylethynyl)-5,6,7,8-tetrahydroquinolin-5-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCc3nc(C#Cc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C24H21NO3S/c1-18-10-15-21(16-11-18)29(26,27)28-24-9-5-8-23-22(24)17-14-20(25-23)13-12-19-6-3-2-4-7-19/h2-4,6-7,10-11,14-17,24H,5,8-9H2,1H3 |
| InChIKey | ISJOXBNZJWUEGH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|