C23H32NO3+ — CID 11877186
(2S,3S,4S,6R)-2,6-bis(4-methoxyphenyl)-3-methyl-4-propylpiperidin-1-ium-4-ol (PubChem CID 11877186) has the molecular formula C23H32NO3+ and a molecular weight of 370.51 g/mol. Its IUPAC name is (2S,3S,4S,6R)-2,6-bis(4-methoxyphenyl)-3-methyl-4-propylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3S,4S,6R)-2,6-bis(4-methoxyphenyl)-3-methyl-4-propylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 11877186 |
| Molecular Formula | C23H32NO3+ |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (2S,3S,4S,6R)-2,6-bis(4-methoxyphenyl)-3-methyl-4-propylpiperidin-1-ium-4-ol |
| SMILES | CCC[C@]1(O)C[C@H](c2ccc(OC)cc2)[NH2+]C(c2ccc(OC)cc2)[C@@H]1C |
| InChI | InChI=1S/C23H31NO3/c1-5-14-23(25)15-21(17-6-10-19(26-3)11-7-17)24-22(16(23)2)18-8-12-20(27-4)13-9-18/h6-13,16,21-22,24-25H,5,14-15H2,1-4H3/p+1/t16-,21+,22?,23-/m0/s1 |
| InChIKey | XVMYIMXBHZVAHC-CWEYIFPJSA-O |
| XLogP | 3.62 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |