C21H25Cl2NO — CID 2065827
(2S,3R,4S,6R)-2,6-bis(4-chlorophenyl)-3-methyl-4-propylpiperidin-4-ol (PubChem CID 2065827) has the molecular formula C21H25Cl2NO and a molecular weight of 378.34 g/mol. Its IUPAC name is (2S,3R,4S,6R)-2,6-bis(4-chlorophenyl)-3-methyl-4-propylpiperidin-4-ol.
| Compound Name | (2S,3R,4S,6R)-2,6-bis(4-chlorophenyl)-3-methyl-4-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 2065827 |
| Molecular Formula | C21H25Cl2NO |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2S,3R,4S,6R)-2,6-bis(4-chlorophenyl)-3-methyl-4-propylpiperidin-4-ol |
| SMILES | CCC[C@]1(O)C[C@H](c2ccc(Cl)cc2)N[C@H](c2ccc(Cl)cc2)[C@H]1C |
| InChI | InChI=1S/C21H25Cl2NO/c1-3-12-21(25)13-19(15-4-8-17(22)9-5-15)24-20(14(21)2)16-6-10-18(23)11-7-16/h4-11,14,19-20,24-25H,3,12-13H2,1-2H3/t14-,19-,20+,21+/m1/s1 |
| InChIKey | JNMBOTCAWAEZQM-PLBGURBNSA-N |
| XLogP | 5.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |