C22H27Cl2NO — CID 100875032
(2S,3R,4R,5R,6R)-2,6-bis(4-chlorophenyl)-3,4-dimethyl-5-propylpiperidin-4-ol (PubChem CID 100875032) has the molecular formula C22H27Cl2NO and a molecular weight of 392.37 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2,6-bis(4-chlorophenyl)-3,4-dimethyl-5-propylpiperidin-4-ol.
| Compound Name | (2S,3R,4R,5R,6R)-2,6-bis(4-chlorophenyl)-3,4-dimethyl-5-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 100875032 |
| Molecular Formula | C22H27Cl2NO |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2,6-bis(4-chlorophenyl)-3,4-dimethyl-5-propylpiperidin-4-ol |
| SMILES | CCC[C@@H]1[C@H](c2ccc(Cl)cc2)N[C@H](c2ccc(Cl)cc2)[C@@H](C)[C@@]1(C)O |
| InChI | InChI=1S/C22H27Cl2NO/c1-4-5-19-21(16-8-12-18(24)13-9-16)25-20(14(2)22(19,3)26)15-6-10-17(23)11-7-15/h6-14,19-21,25-26H,4-5H2,1-3H3/t14-,19-,20+,21+,22-/m1/s1 |
| InChIKey | LIBIPIXHWFBTLG-IOWAXREISA-N |
| XLogP | 6.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |