C25H37N3O — CID 3148801
2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol (PubChem CID 3148801) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol.
| Compound Name | 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 3148801 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol |
| SMILES | CCC1(O)C(C)C(c2ccc(N(C)C)cc2)NC(c2ccc(N(C)C)cc2)C1C |
| InChI | InChI=1S/C25H37N3O/c1-8-25(29)17(2)23(19-9-13-21(14-10-19)27(4)5)26-24(18(25)3)20-11-15-22(16-12-20)28(6)7/h9-18,23-24,26,29H,8H2,1-7H3 |
| InChIKey | KJQBZHDKPAMYIE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|