About 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol
2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol (PubChem CID 3148801) has the molecular formula C25H37N3O
and a molecular weight of 395.59 g/mol. Its IUPAC name is 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol |
| PubChem CID | 3148801 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol |
| SMILES | CCC1(O)C(C)C(c2ccc(N(C)C)cc2)NC(c2ccc(N(C)C)cc2)C1C |
| InChI | InChI=1S/C25H37N3O/c1-8-25(29)17(2)23(19-9-13-21(14-10-19)27(4)5)26-24(18(25)3)20-11-15-22(16-12-20)28(6)7/h9-18,23-24,26,29H,8H2,1-7H3 |
| InChIKey | KJQBZHDKPAMYIE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol?
The IUPAC name of 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol (CID 3148801) is 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol.
What is the SMILES notation for 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol?
The canonical SMILES for 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol is CCC1(O)C(C)C(c2ccc(N(C)C)cc2)NC(c2ccc(N(C)C)cc2)C1C.
What is the InChIKey of 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol?
The InChIKey is KJQBZHDKPAMYIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H37N3O/c1-8-25(29)17(2)23(19-9-13-21(14-10-19)27(4)5)26-24(18(25)3)20-11-15-22(16-12-20)28(6)7/h9-18,23-24,26,29H,8H2,1-7H3.
What are the key properties of 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol?
2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol has a molecular weight of 395.59 g/mol, XLogP of 4.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[4-(dimethylamino)phenyl]-4-ethyl-3,5-dimethylpiperidin-4-ol is sourced from PubChem (CID 3148801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).