C22H26N2O — CID 10616737
1-[4-(4-aminophenyl)but-3-ynyl]-4-benzylpiperidin-4-ol (PubChem CID 10616737) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)but-3-ynyl]-4-benzylpiperidin-4-ol.
| Compound Name | 1-[4-(4-aminophenyl)but-3-ynyl]-4-benzylpiperidin-4-ol |
|---|---|
| PubChem CID | 10616737 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[4-(4-aminophenyl)but-3-ynyl]-4-benzylpiperidin-4-ol |
| SMILES | Nc1ccc(C#CCCN2CCC(O)(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O/c23-21-11-9-19(10-12-21)6-4-5-15-24-16-13-22(25,14-17-24)18-20-7-2-1-3-8-20/h1-3,7-12,25H,5,13-18,23H2 |
| InChIKey | ISVKCDBNGIPSLZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|