C23H30Cl2NO+ — CID 6562589
(2R,3R,5S,6S)-4-butyl-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol (PubChem CID 6562589) has the molecular formula C23H30Cl2NO+ and a molecular weight of 407.41 g/mol. Its IUPAC name is (2R,3R,5S,6S)-4-butyl-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol.
| Compound Name | (2R,3R,5S,6S)-4-butyl-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 6562589 |
| Molecular Formula | C23H30Cl2NO+ |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2R,3R,5S,6S)-4-butyl-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol |
| SMILES | CCCCC1(O)[C@H](C)[C@H](c2ccc(Cl)cc2)[NH2+][C@H](c2ccc(Cl)cc2)[C@@H]1C |
| InChI | InChI=1S/C23H29Cl2NO/c1-4-5-14-23(27)15(2)21(17-6-10-19(24)11-7-17)26-22(16(23)3)18-8-12-20(25)13-9-18/h6-13,15-16,21-22,26-27H,4-5,14H2,1-3H3/p+1/t15-,16+,21-,22+,23? |
| InChIKey | JIMPELPXBXADEI-WKWMAYMFSA-O |
| XLogP | 5.55 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |