C19H22Cl2NO+ — CID 7310329
(2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol (PubChem CID 7310329) has the molecular formula C19H22Cl2NO+ and a molecular weight of 351.30 g/mol. Its IUPAC name is (2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7310329 |
| Molecular Formula | C19H22Cl2NO+ |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (2S,3S,5S,6S)-2,6-bis(4-chlorophenyl)-3,5-dimethylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1C(O)[C@@H](C)[C@@H](c2ccc(Cl)cc2)[NH2+][C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2NO/c1-11-17(13-3-7-15(20)8-4-13)22-18(12(2)19(11)23)14-5-9-16(21)10-6-14/h3-12,17-19,22-23H,1-2H3/p+1/t11-,12-,17-,18-/m0/s1 |
| InChIKey | YOCSCRSTBWZYLM-BMEPFDOTSA-O |
| XLogP | 3.99 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |