C20H20Cl2NO+ — CID 7329764
(1R,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azoniabicyclo[3.3.1]nonan-9-one (PubChem CID 7329764) has the molecular formula C20H20Cl2NO+ and a molecular weight of 361.29 g/mol. Its IUPAC name is (1R,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azoniabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1R,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azoniabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 7329764 |
| Molecular Formula | C20H20Cl2NO+ |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (1R,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azoniabicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1[C@H]2CCC[C@@H]1[C@H](c1ccc(Cl)cc1)[NH2+][C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2NO/c21-14-8-4-12(5-9-14)18-16-2-1-3-17(20(16)24)19(23-18)13-6-10-15(22)11-7-13/h4-11,16-19,23H,1-3H2/p+1/t16-,17+,18+,19- |
| InChIKey | PORVTVGCOCXZTB-SEXKYXSUSA-O |
| XLogP | 4.34 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |