C20H22NO3+ — CID 23350779
(1S,2S,4S,5S)-2,4-bis(2-hydroxyphenyl)-3-azoniabicyclo[3.3.1]nonan-9-one (PubChem CID 23350779) has the molecular formula C20H22NO3+ and a molecular weight of 324.40 g/mol. Its IUPAC name is (1S,2S,4S,5S)-2,4-bis(2-hydroxyphenyl)-3-azoniabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1S,2S,4S,5S)-2,4-bis(2-hydroxyphenyl)-3-azoniabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 23350779 |
| Molecular Formula | C20H22NO3+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (1S,2S,4S,5S)-2,4-bis(2-hydroxyphenyl)-3-azoniabicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1[C@H]2CCC[C@H]1[C@@H](c1ccccc1O)[NH2+][C@@H]2c1ccccc1O |
| InChI | InChI=1S/C20H21NO3/c22-16-10-3-1-6-12(16)18-14-8-5-9-15(20(14)24)19(21-18)13-7-2-4-11-17(13)23/h1-4,6-7,10-11,14-15,18-19,21-23H,5,8-9H2/p+1/t14-,15-,18+,19+/m0/s1 |
| InChIKey | VPRRXGCLWRHPQO-ILRDRHFLSA-O |
| XLogP | 2.44 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|