C34H24Cl4O2 — CID 122374957
4,5,9,10-tetrakis(4-chlorophenyl)tricyclo[6.2.0.03,6]decane-2,7-dione (PubChem CID 122374957) has the molecular formula C34H24Cl4O2 and a molecular weight of 606.38 g/mol. Its IUPAC name is 4,5,9,10-tetrakis(4-chlorophenyl)tricyclo[6.2.0.03,6]decane-2,7-dione.
| Compound Name | 4,5,9,10-tetrakis(4-chlorophenyl)tricyclo[6.2.0.03,6]decane-2,7-dione |
|---|---|
| PubChem CID | 122374957 |
| Molecular Formula | C34H24Cl4O2 |
| Molecular Weight | 606.38 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | 4,5,9,10-tetrakis(4-chlorophenyl)tricyclo[6.2.0.03,6]decane-2,7-dione |
| SMILES | O=C1C2C(C(=O)C3C1C(c1ccc(Cl)cc1)C3c1ccc(Cl)cc1)C(c1ccc(Cl)cc1)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H24Cl4O2/c35-21-9-1-17(2-10-21)25-26(18-3-11-22(36)12-4-18)30-29(25)33(39)31-27(19-5-13-23(37)14-6-19)28(32(31)34(30)40)20-7-15-24(38)16-8-20/h1-16,25-32H |
| InChIKey | PYVLTGNAUHNUEE-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.38 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |