C20H19Cl2NO — CID 23376315
(1S,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azabicyclo[3.3.1]nonan-9-one (PubChem CID 23376315) has the molecular formula C20H19Cl2NO and a molecular weight of 360.28 g/mol. Its IUPAC name is (1S,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1S,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 23376315 |
| Molecular Formula | C20H19Cl2NO |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (1S,2R,4S,5S)-2,4-bis(4-chlorophenyl)-3-azabicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1[C@H]2CCC[C@H]1[C@H](c1ccc(Cl)cc1)N[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2NO/c21-14-8-4-12(5-9-14)18-16-2-1-3-17(20(16)24)19(23-18)13-6-10-15(22)11-7-13/h4-11,16-19,23H,1-3H2/t16-,17-,18-,19+/m0/s1 |
| InChIKey | PORVTVGCOCXZTB-CADBVGFASA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |