C26H33NO7 — CID 71473110
(1R,2R,4S,5S)-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one (PubChem CID 71473110) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is (1R,2R,4S,5S)-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1R,2R,4S,5S)-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 71473110 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (1R,2R,4S,5S)-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one |
| SMILES | COc1cc([C@H]2N[C@@H](c3cc(OC)c(OC)c(OC)c3)[C@H]3CCC[C@@H]2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H33NO7/c1-29-18-10-14(11-19(30-2)25(18)33-5)22-16-8-7-9-17(24(16)28)23(27-22)15-12-20(31-3)26(34-6)21(13-15)32-4/h10-13,16-17,22-23,27H,7-9H2,1-6H3/t16-,17+,22+,23- |
| InChIKey | HHCWAPXYWQNGQT-HLYHAVAHSA-N |
| XLogP | 4.11 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |