C14H18N2O6 — CID 674181
(5R,6R)-5-nitro-6-(3,4,5-trimethoxyphenyl)piperidin-2-one (PubChem CID 674181) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is (5R,6R)-5-nitro-6-(3,4,5-trimethoxyphenyl)piperidin-2-one.
| Compound Name | (5R,6R)-5-nitro-6-(3,4,5-trimethoxyphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 674181 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (5R,6R)-5-nitro-6-(3,4,5-trimethoxyphenyl)piperidin-2-one |
| SMILES | COc1cc([C@H]2NC(=O)CC[C@H]2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C14H18N2O6/c1-20-10-6-8(7-11(21-2)14(10)22-3)13-9(16(18)19)4-5-12(17)15-13/h6-7,9,13H,4-5H2,1-3H3,(H,15,17)/t9-,13-/m1/s1 |
| InChIKey | FAEBZOJHRLNECM-NOZJJQNGSA-N |
| XLogP | 1.31 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|