C12H13ClN2O5 — CID 703180
(5R,6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-5-nitropiperidin-2-one (PubChem CID 703180) has the molecular formula C12H13ClN2O5 and a molecular weight of 300.70 g/mol. Its IUPAC name is (5R,6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-5-nitropiperidin-2-one.
| Compound Name | (5R,6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-5-nitropiperidin-2-one |
|---|---|
| PubChem CID | 703180 |
| Molecular Formula | C12H13ClN2O5 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (5R,6R)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-5-nitropiperidin-2-one |
| SMILES | COc1cc([C@H]2NC(=O)CC[C@H]2[N+](=O)[O-])cc(Cl)c1O |
| InChI | InChI=1S/C12H13ClN2O5/c1-20-9-5-6(4-7(13)12(9)17)11-8(15(18)19)2-3-10(16)14-11/h4-5,8,11,17H,2-3H2,1H3,(H,14,16)/t8-,11-/m1/s1 |
| InChIKey | RTXKQSOCNPKWMF-LDYMZIIASA-N |
| XLogP | 1.65 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|