C14H17BrN2O6 — CID 1044923
(5S,6S)-6-(2-bromo-3,4,5-trimethoxyphenyl)-5-nitropiperidin-2-one (PubChem CID 1044923) has the molecular formula C14H17BrN2O6 and a molecular weight of 389.20 g/mol. Its IUPAC name is (5S,6S)-6-(2-bromo-3,4,5-trimethoxyphenyl)-5-nitropiperidin-2-one.
| Compound Name | (5S,6S)-6-(2-bromo-3,4,5-trimethoxyphenyl)-5-nitropiperidin-2-one |
|---|---|
| PubChem CID | 1044923 |
| Molecular Formula | C14H17BrN2O6 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (5S,6S)-6-(2-bromo-3,4,5-trimethoxyphenyl)-5-nitropiperidin-2-one |
| SMILES | COc1cc([C@@H]2NC(=O)CC[C@@H]2[N+](=O)[O-])c(Br)c(OC)c1OC |
| InChI | InChI=1S/C14H17BrN2O6/c1-21-9-6-7(11(15)14(23-3)13(9)22-2)12-8(17(19)20)4-5-10(18)16-12/h6,8,12H,4-5H2,1-3H3,(H,16,18)/t8-,12-/m0/s1 |
| InChIKey | XUYCOOVBDZXMHA-UFBFGSQYSA-N |
| XLogP | 2.07 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|