C18H18N2O4 — CID 705369
(5S,6S)-5-nitro-6-(2-phenylmethoxyphenyl)piperidin-2-one (PubChem CID 705369) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is (5S,6S)-5-nitro-6-(2-phenylmethoxyphenyl)piperidin-2-one.
| Compound Name | (5S,6S)-5-nitro-6-(2-phenylmethoxyphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 705369 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (5S,6S)-5-nitro-6-(2-phenylmethoxyphenyl)piperidin-2-one |
| SMILES | O=C1CC[C@H]([N+](=O)[O-])[C@H](c2ccccc2OCc2ccccc2)N1 |
| InChI | InChI=1S/C18H18N2O4/c21-17-11-10-15(20(22)23)18(19-17)14-8-4-5-9-16(14)24-12-13-6-2-1-3-7-13/h1-9,15,18H,10-12H2,(H,19,21)/t15-,18-/m0/s1 |
| InChIKey | PVMKAAOHTYLXNF-YJBOKZPZSA-N |
| XLogP | 2.86 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|