C23H28O7S — CID 154121584
2,6-bis(3,4,5-trimethoxyphenyl)thian-4-one (PubChem CID 154121584) has the molecular formula C23H28O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2,6-bis(3,4,5-trimethoxyphenyl)thian-4-one.
| Compound Name | 2,6-bis(3,4,5-trimethoxyphenyl)thian-4-one |
|---|---|
| PubChem CID | 154121584 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2,6-bis(3,4,5-trimethoxyphenyl)thian-4-one |
| SMILES | COc1cc(C2CC(=O)CC(c3cc(OC)c(OC)c(OC)c3)S2)cc(OC)c1OC |
| InChI | InChI=1S/C23H28O7S/c1-25-16-7-13(8-17(26-2)22(16)29-5)20-11-15(24)12-21(31-20)14-9-18(27-3)23(30-6)19(10-14)28-4/h7-10,20-21H,11-12H2,1-6H3 |
| InChIKey | HOOKBTUUKAEGOU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |