C11H13N3O4 — CID 78300787
3-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1,2,4-triazol-5-one (PubChem CID 78300787) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 78300787 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1,2,4-triazol-5-one |
| SMILES | COc1cc(C2N=NC(=O)N2)cc(OC)c1OC |
| InChI | InChI=1S/C11H13N3O4/c1-16-7-4-6(10-12-11(15)14-13-10)5-8(17-2)9(7)18-3/h4-5,10H,1-3H3,(H,12,15) |
| InChIKey | VPYZFTVOBCVVKR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |