C12H15NO4S — CID 747825
(2R)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 747825) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (2R)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2R)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 747825 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (2R)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1cc([C@@H]2NC(=O)CS2)cc(OC)c1OC |
| InChI | InChI=1S/C12H15NO4S/c1-15-8-4-7(12-13-10(14)6-18-12)5-9(16-2)11(8)17-3/h4-5,12H,6H2,1-3H3,(H,13,14)/t12-/m1/s1 |
| InChIKey | SRXJNBCCQFXHQD-GFCCVEGCSA-N |
| XLogP | 1.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |