C20H25N3O5S2 — CID 97426703
(4S)-1-(thian-4-yl)-4-(3,4,5-trimethoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 97426703) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is (4S)-1-(thian-4-yl)-4-(3,4,5-trimethoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4S)-1-(thian-4-yl)-4-(3,4,5-trimethoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 97426703 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (4S)-1-(thian-4-yl)-4-(3,4,5-trimethoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | COc1cc([C@@H]2SCC(=O)Nc3c2c(=O)[nH]n3C2CCSCC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N3O5S2/c1-26-13-8-11(9-14(27-2)17(13)28-3)18-16-19(21-15(24)10-30-18)23(22-20(16)25)12-4-6-29-7-5-12/h8-9,12,18H,4-7,10H2,1-3H3,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | BPERVBKUSRVNOK-SFHVURJKSA-N |
| XLogP | 3.05 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |