C19H23N3O4S2 — CID 71829430
4-(3,4-dimethoxyphenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 71829430) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | 4-(3,4-dimethoxyphenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 71829430 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | COc1ccc(C2SCC(=O)Nc3c2c(=O)[nH]n3C2CCSCC2)cc1OC |
| InChI | InChI=1S/C19H23N3O4S2/c1-25-13-4-3-11(9-14(13)26-2)17-16-18(20-15(23)10-28-17)22(21-19(16)24)12-5-7-27-8-6-12/h3-4,9,12,17H,5-8,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | YSUKAXRDIXLYJY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |