C12H15N3O4 — CID 82996110
2-amino-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroimidazol-5-one (PubChem CID 82996110) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-amino-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroimidazol-5-one.
| Compound Name | 2-amino-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 82996110 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-amino-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroimidazol-5-one |
| SMILES | COc1cc(C2N=C(N)NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C12H15N3O4/c1-17-7-4-6(5-8(18-2)10(7)19-3)9-11(16)15-12(13)14-9/h4-5,9H,1-3H3,(H3,13,14,15,16) |
| InChIKey | LGSUXMCRTRKZNH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |