C21H27N3O4 — CID 22149198
3,4,5-trimethoxy-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide (PubChem CID 22149198) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 22149198 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3,4,5-trimethoxy-N-[N'-(4-phenylbutyl)carbamimidoyl]benzamide |
| SMILES | COc1cc(C(=O)N/C(N)=N/CCCCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H27N3O4/c1-26-17-13-16(14-18(27-2)19(17)28-3)20(25)24-21(22)23-12-8-7-11-15-9-5-4-6-10-15/h4-6,9-10,13-14H,7-8,11-12H2,1-3H3,(H3,22,23,24,25) |
| InChIKey | HIIDJDRWZXTWHJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|