C16H22N2O4S — CID 771169
N-(4,5-dihydro-1,3-thiazol-2-yl)-3,4,5-triethoxybenzamide (PubChem CID 771169) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 771169 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC2=NCCS2)cc(OCC)c1OCC |
| InChI | InChI=1S/C16H22N2O4S/c1-4-20-12-9-11(15(19)18-16-17-7-8-23-16)10-13(21-5-2)14(12)22-6-3/h9-10H,4-8H2,1-3H3,(H,17,18,19) |
| InChIKey | XCUPLAWCNOBCRC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |