C24H31NO6 — CID 2870146
N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 2870146) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2870146 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[[1-(3,4-dimethoxyphenyl)cyclopentyl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(C2(CNC(=O)c3cc(OC)c(OC)c(OC)c3)CCCC2)cc1OC |
| InChI | InChI=1S/C24H31NO6/c1-27-18-9-8-17(14-19(18)28-2)24(10-6-7-11-24)15-25-23(26)16-12-20(29-3)22(31-5)21(13-16)30-4/h8-9,12-14H,6-7,10-11,15H2,1-5H3,(H,25,26) |
| InChIKey | PISBTWXSSKHGPG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |