C15H17NO5 — CID 43247
Benzamide, N-furfuryl-3,4,5-trimethoxy- (PubChem CID 43247) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,4,5-trimethoxybenzamide.
| Compound Name | Benzamide, N-furfuryl-3,4,5-trimethoxy- |
|---|---|
| PubChem CID | 43247 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,4,5-trimethoxybenzamide |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)NCC2=CC=CO2 |
| InChI | InChI=1S/C15H17NO5/c1-18-12-7-10(8-13(19-2)14(12)20-3)15(17)16-9-11-5-4-6-21-11/h4-8H,9H2,1-3H3,(H,16,17) |
| InChIKey | PEUKYEPLCRXPHU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 324 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |