C14H19NO5 — CID 12478
View drug profile → trimetozinemorpholin-4-yl-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 12478) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is morpholin-4-yl-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | morpholin-4-yl-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 12478 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | morpholin-4-yl-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C14H19NO5/c1-17-11-8-10(9-12(18-2)13(11)19-3)14(16)15-4-6-20-7-5-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | XWVOEFLBOSSYGM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |