C10H13NO4 — CID 18334
3,4,5-trimethoxybenzamide (PubChem CID 18334) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3,4,5-trimethoxybenzamide.
| Compound Name | 3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 18334 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C10H13NO4/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H2,11,12) |
| InChIKey | GGNMTJKRHHLJHH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |