About methyl 3,4,5-trimethoxybenzoate
methyl 3,4,5-trimethoxybenzoate (PubChem CID 15956) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxybenzoate.
Molecular Properties
| Compound Name | methyl 3,4,5-trimethoxybenzoate |
| PubChem CID | 15956 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl 3,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C11H14O5/c1-13-8-5-7(11(12)16-4)6-9(14-2)10(8)15-3/h5-6H,1-4H3 |
| InChIKey | KACHFMOHOPLTNX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3,4,5-trimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,4,5-trimethoxybenzoate?
The IUPAC name of methyl 3,4,5-trimethoxybenzoate (CID 15956) is methyl 3,4,5-trimethoxybenzoate.
What is the SMILES notation for methyl 3,4,5-trimethoxybenzoate?
The canonical SMILES for methyl 3,4,5-trimethoxybenzoate is COC(=O)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of methyl 3,4,5-trimethoxybenzoate?
The InChIKey is KACHFMOHOPLTNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c1-13-8-5-7(11(12)16-4)6-9(14-2)10(8)15-3/h5-6H,1-4H3.
What are the key properties of methyl 3,4,5-trimethoxybenzoate?
methyl 3,4,5-trimethoxybenzoate has a molecular weight of 226.23 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4,5-trimethoxybenzoate is sourced from PubChem (CID 15956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).