C10H12O5 — CID 8357
3,4,5-trimethoxybenzoic acid (PubChem CID 8357) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 3,4,5-trimethoxybenzoic acid.
| Compound Name | 3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 8357 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) |
| InChIKey | SJSOFNCYXJUNBT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |