C25H31NO5 — CID 71491001
(1S,2R,4S,5R)-2,4-bis(3,4-dimethoxyphenyl)-7-methyl-3-azabicyclo[3.3.1]nonan-9-one (PubChem CID 71491001) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (1S,2R,4S,5R)-2,4-bis(3,4-dimethoxyphenyl)-7-methyl-3-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1S,2R,4S,5R)-2,4-bis(3,4-dimethoxyphenyl)-7-methyl-3-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 71491001 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (1S,2R,4S,5R)-2,4-bis(3,4-dimethoxyphenyl)-7-methyl-3-azabicyclo[3.3.1]nonan-9-one |
| SMILES | COc1ccc([C@H]2N[C@@H](c3ccc(OC)c(OC)c3)[C@@H]3CC(C)C[C@H]2C3=O)cc1OC |
| InChI | InChI=1S/C25H31NO5/c1-14-10-17-23(15-6-8-19(28-2)21(12-15)30-4)26-24(18(11-14)25(17)27)16-7-9-20(29-3)22(13-16)31-5/h6-9,12-14,17-18,23-24,26H,10-11H2,1-5H3/t14?,17-,18+,23-,24+ |
| InChIKey | HDVULXKSKURAJH-DKERGVTASA-N |
| XLogP | 4.34 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |