C15H18N2O4 — CID 52905656
(8R)-8-(3,4-dimethoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione (PubChem CID 52905656) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is (8R)-8-(3,4-dimethoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione.
| Compound Name | (8R)-8-(3,4-dimethoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione |
|---|---|
| PubChem CID | 52905656 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (8R)-8-(3,4-dimethoxyphenyl)-1-methyl-2,6-diazabicyclo[2.2.2]octane-3,5-dione |
| SMILES | COc1ccc([C@@H]2CC3(C)NC(=O)C2C(=O)N3)cc1OC |
| InChI | InChI=1S/C15H18N2O4/c1-15-7-9(12(13(18)16-15)14(19)17-15)8-4-5-10(20-2)11(6-8)21-3/h4-6,9,12H,7H2,1-3H3,(H,16,18)(H,17,19)/t9-,12?,15?/m0/s1 |
| InChIKey | VZVHELVYZOFGHC-AAYUTKSQSA-N |
| XLogP | 0.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|