C25H28O6 — CID 101448114
(1R,5S,6R,7S)-6,7-bis(3,4-dimethoxyphenyl)-3,3-dimethylbicyclo[3.2.0]heptane-2,4-dione (PubChem CID 101448114) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is (1R,5S,6R,7S)-6,7-bis(3,4-dimethoxyphenyl)-3,3-dimethylbicyclo[3.2.0]heptane-2,4-dione.
| Compound Name | (1R,5S,6R,7S)-6,7-bis(3,4-dimethoxyphenyl)-3,3-dimethylbicyclo[3.2.0]heptane-2,4-dione |
|---|---|
| PubChem CID | 101448114 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (1R,5S,6R,7S)-6,7-bis(3,4-dimethoxyphenyl)-3,3-dimethylbicyclo[3.2.0]heptane-2,4-dione |
| SMILES | COc1ccc([C@@H]2[C@H]3C(=O)C(C)(C)C(=O)[C@H]3[C@@H]2c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H28O6/c1-25(2)23(26)21-19(13-7-9-15(28-3)17(11-13)30-5)20(22(21)24(25)27)14-8-10-16(29-4)18(12-14)31-6/h7-12,19-22H,1-6H3/t19-,20+,21+,22- |
| InChIKey | SQMJELQKVHHEFU-ZDNVTZCJSA-N |
| XLogP | 4.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|