C19H22O5 — CID 10806312
(1R,6S,7R,8R)-7-(3,4-dimethoxyphenyl)-3-methoxy-4,8-dimethylbicyclo[4.2.0]oct-3-ene-2,5-dione (PubChem CID 10806312) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (1R,6S,7R,8R)-7-(3,4-dimethoxyphenyl)-3-methoxy-4,8-dimethylbicyclo[4.2.0]oct-3-ene-2,5-dione.
| Compound Name | (1R,6S,7R,8R)-7-(3,4-dimethoxyphenyl)-3-methoxy-4,8-dimethylbicyclo[4.2.0]oct-3-ene-2,5-dione |
|---|---|
| PubChem CID | 10806312 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (1R,6S,7R,8R)-7-(3,4-dimethoxyphenyl)-3-methoxy-4,8-dimethylbicyclo[4.2.0]oct-3-ene-2,5-dione |
| SMILES | COC1=C(C)C(=O)[C@@H]2[C@H](C1=O)[C@H](C)[C@H]2c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22O5/c1-9-14(11-6-7-12(22-3)13(8-11)23-4)16-15(9)18(21)19(24-5)10(2)17(16)20/h6-9,14-16H,1-5H3/t9-,14+,15-,16+/m1/s1 |
| InChIKey | WGTRRFBDTIDTNO-JIWMEVSISA-N |
| XLogP | 2.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |